About ethyl (1R,4R)-2,2-difluorobicyclo[2.1.0]pentane-1-carboxylate
ethyl (1R,4R)-2,2-difluorobicyclo[2.1.0]pentane-1-carboxylate (PubChem CID 10678846) has the molecular formula C8H10F2O2
and a molecular weight of 176.16 g/mol. Its IUPAC name is ethyl (1R,4R)-2,2-difluorobicyclo[2.1.0]pentane-1-carboxylate.
Analyze ethyl (1R,4R)-2,2-difluorobicyclo[2.1.0]pentane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (1R,4R)-2,2-difluorobicyclo[2.1.0]pentane-1-carboxylate?
The IUPAC name of ethyl (1R,4R)-2,2-difluorobicyclo[2.1.0]pentane-1-carboxylate (CID 10678846) is ethyl (1R,4R)-2,2-difluorobicyclo[2.1.0]pentane-1-carboxylate.
What is the SMILES notation for ethyl (1R,4R)-2,2-difluorobicyclo[2.1.0]pentane-1-carboxylate?
The canonical SMILES for ethyl (1R,4R)-2,2-difluorobicyclo[2.1.0]pentane-1-carboxylate is CCOC(=O)[C@@]12C[C@@H]1CC2(F)F.
What is the InChIKey of ethyl (1R,4R)-2,2-difluorobicyclo[2.1.0]pentane-1-carboxylate?
The InChIKey is PSCYOLNBMSJYKV-IYSWYEEDSA-N. The full InChI is InChI=1S/C8H10F2O2/c1-2-12-6(11)7-3-5(7)4-8(7,9)10/h5H,2-4H2,1H3/t5-,7-/m1/s1.
What are the key properties of ethyl (1R,4R)-2,2-difluorobicyclo[2.1.0]pentane-1-carboxylate?
ethyl (1R,4R)-2,2-difluorobicyclo[2.1.0]pentane-1-carboxylate has a molecular weight of 176.16 g/mol, XLogP of 1.59, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (1R,4R)-2,2-difluorobicyclo[2.1.0]pentane-1-carboxylate is sourced from PubChem (CID 10678846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).