C17H17FO7S — CID 11668113
diethyl 3-[(4-fluorophenyl)methylsulfanyl]-4,5-dioxooxolane-2,2-dicarboxylate (PubChem CID 11668113) has the molecular formula C17H17FO7S and a molecular weight of 384.38 g/mol. Its IUPAC name is diethyl 3-[(4-fluorophenyl)methylsulfanyl]-4,5-dioxooxolane-2,2-dicarboxylate.
| Compound Name | diethyl 3-[(4-fluorophenyl)methylsulfanyl]-4,5-dioxooxolane-2,2-dicarboxylate |
|---|---|
| PubChem CID | 11668113 |
| Molecular Formula | C17H17FO7S |
| Molecular Weight | 384.38 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | diethyl 3-[(4-fluorophenyl)methylsulfanyl]-4,5-dioxooxolane-2,2-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)OC(=O)C(=O)C1SCc1ccc(F)cc1 |
| InChI | InChI=1S/C17H17FO7S/c1-3-23-15(21)17(16(22)24-4-2)13(12(19)14(20)25-17)26-9-10-5-7-11(18)8-6-10/h5-8,13H,3-4,9H2,1-2H3 |
| InChIKey | NQTFIJJQPGWMQC-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.38 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|