C18H14BrFO4 — CID 25213430
ethyl (2R,3R)-2-(3-bromophenyl)-3-fluoro-4-oxo-2H-chromene-3-carboxylate (PubChem CID 25213430) has the molecular formula C18H14BrFO4 and a molecular weight of 393.21 g/mol. Its IUPAC name is ethyl (2R,3R)-2-(3-bromophenyl)-3-fluoro-4-oxo-2H-chromene-3-carboxylate.
| Compound Name | ethyl (2R,3R)-2-(3-bromophenyl)-3-fluoro-4-oxo-2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 25213430 |
| Molecular Formula | C18H14BrFO4 |
| Molecular Weight | 393.21 g/mol |
| Exact Mass | 392.01 |
| IUPAC Name | ethyl (2R,3R)-2-(3-bromophenyl)-3-fluoro-4-oxo-2H-chromene-3-carboxylate |
| SMILES | CCOC(=O)[C@]1(F)C(=O)c2ccccc2O[C@@H]1c1cccc(Br)c1 |
| InChI | InChI=1S/C18H14BrFO4/c1-2-23-17(22)18(20)15(21)13-8-3-4-9-14(13)24-16(18)11-6-5-7-12(19)10-11/h3-10,16H,2H2,1H3/t16-,18+/m1/s1 |
| InChIKey | OLGQZALYKMCPMP-AEFFLSMTSA-N |
| XLogP | 4.04 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.21 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|