About diethyl 1-bromo-6,11-dioxobenzo[b]xanthene-12,12-dicarboxylate
diethyl 1-bromo-6,11-dioxobenzo[b]xanthene-12,12-dicarboxylate (PubChem CID 100953913) has the molecular formula C23H17BrO7
and a molecular weight of 485.29 g/mol. Its IUPAC name is diethyl 1-bromo-6,11-dioxobenzo[b]xanthene-12,12-dicarboxylate.
Molecular Properties
| Compound Name | diethyl 1-bromo-6,11-dioxobenzo[b]xanthene-12,12-dicarboxylate |
| PubChem CID | 100953913 |
| Molecular Formula | C23H17BrO7 |
| Molecular Weight | 485.29 g/mol |
| Exact Mass | 484.02 |
| IUPAC Name | diethyl 1-bromo-6,11-dioxobenzo[b]xanthene-12,12-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)C2=C(Oc3cccc(Br)c31)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C23H17BrO7/c1-3-29-21(27)23(22(28)30-4-2)16-14(24)10-7-11-15(16)31-20-17(23)18(25)12-8-5-6-9-13(12)19(20)26/h5-11H,3-4H2,1-2H3 |
| InChIKey | AQRWCXBAGOAYAW-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 485.29 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze diethyl 1-bromo-6,11-dioxobenzo[b]xanthene-12,12-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 1-bromo-6,11-dioxobenzo[b]xanthene-12,12-dicarboxylate?
The IUPAC name of diethyl 1-bromo-6,11-dioxobenzo[b]xanthene-12,12-dicarboxylate (CID 100953913) is diethyl 1-bromo-6,11-dioxobenzo[b]xanthene-12,12-dicarboxylate.
What is the SMILES notation for diethyl 1-bromo-6,11-dioxobenzo[b]xanthene-12,12-dicarboxylate?
The canonical SMILES for diethyl 1-bromo-6,11-dioxobenzo[b]xanthene-12,12-dicarboxylate is CCOC(=O)C1(C(=O)OCC)C2=C(Oc3cccc(Br)c31)C(=O)c1ccccc1C2=O.
What is the InChIKey of diethyl 1-bromo-6,11-dioxobenzo[b]xanthene-12,12-dicarboxylate?
The InChIKey is AQRWCXBAGOAYAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H17BrO7/c1-3-29-21(27)23(22(28)30-4-2)16-14(24)10-7-11-15(16)31-20-17(23)18(25)12-8-5-6-9-13(12)19(20)26/h5-11H,3-4H2,1-2H3.
What are the key properties of diethyl 1-bromo-6,11-dioxobenzo[b]xanthene-12,12-dicarboxylate?
diethyl 1-bromo-6,11-dioxobenzo[b]xanthene-12,12-dicarboxylate has a molecular weight of 485.29 g/mol, XLogP of 3.54, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 1-bromo-6,11-dioxobenzo[b]xanthene-12,12-dicarboxylate is sourced from PubChem (CID 100953913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).