C23H17BrO7 — CID 100953913
diethyl 1-bromo-6,11-dioxobenzo[b]xanthene-12,12-dicarboxylate (PubChem CID 100953913) has the molecular formula C23H17BrO7 and a molecular weight of 485.29 g/mol. Its IUPAC name is diethyl 1-bromo-6,11-dioxobenzo[b]xanthene-12,12-dicarboxylate.
| Compound Name | diethyl 1-bromo-6,11-dioxobenzo[b]xanthene-12,12-dicarboxylate |
|---|---|
| PubChem CID | 100953913 |
| Molecular Formula | C23H17BrO7 |
| Molecular Weight | 485.29 g/mol |
| Exact Mass | 484.02 |
| IUPAC Name | diethyl 1-bromo-6,11-dioxobenzo[b]xanthene-12,12-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)C2=C(Oc3cccc(Br)c31)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C23H17BrO7/c1-3-29-21(27)23(22(28)30-4-2)16-14(24)10-7-11-15(16)31-20-17(23)18(25)12-8-5-6-9-13(12)19(20)26/h5-11H,3-4H2,1-2H3 |
| InChIKey | AQRWCXBAGOAYAW-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.29 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|