C22H22O7 — CID 122404104
triethyl benzo[f]chromene-1,1,2-tricarboxylate (PubChem CID 122404104) has the molecular formula C22H22O7 and a molecular weight of 398.41 g/mol. Its IUPAC name is triethyl benzo[f]chromene-1,1,2-tricarboxylate.
| Compound Name | triethyl benzo[f]chromene-1,1,2-tricarboxylate |
|---|---|
| PubChem CID | 122404104 |
| Molecular Formula | C22H22O7 |
| Molecular Weight | 398.41 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | triethyl benzo[f]chromene-1,1,2-tricarboxylate |
| SMILES | CCOC(=O)C1=COc2ccc3ccccc3c2C1(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C22H22O7/c1-4-26-19(23)16-13-29-17-12-11-14-9-7-8-10-15(14)18(17)22(16,20(24)27-5-2)21(25)28-6-3/h7-13H,4-6H2,1-3H3 |
| InChIKey | PBYKHJGTJCCOTA-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.41 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|