C18H15NO6 — CID 122221541
ethyl (11S,15R)-2,9,12-trioxo-13-oxa-17-azatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3,5,7-tetraene-11-carboxylate (PubChem CID 122221541) has the molecular formula C18H15NO6 and a molecular weight of 341.32 g/mol. Its IUPAC name is ethyl (11S,15R)-2,9,12-trioxo-13-oxa-17-azatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3,5,7-tetraene-11-carboxylate.
| Compound Name | ethyl (11S,15R)-2,9,12-trioxo-13-oxa-17-azatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3,5,7-tetraene-11-carboxylate |
|---|---|
| PubChem CID | 122221541 |
| Molecular Formula | C18H15NO6 |
| Molecular Weight | 341.32 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | ethyl (11S,15R)-2,9,12-trioxo-13-oxa-17-azatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3,5,7-tetraene-11-carboxylate |
| SMILES | CCOC(=O)[C@]12C(=O)OC[C@H]1CNC1=C2C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H15NO6/c1-2-24-16(22)18-9(8-25-17(18)23)7-19-13-12(18)14(20)10-5-3-4-6-11(10)15(13)21/h3-6,9,19H,2,7-8H2,1H3/t9-,18+/m1/s1 |
| InChIKey | NEKDCEIQVYVIRH-LZVRBXCZSA-N |
| XLogP | 0.65 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.32 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|