C15H10O3 — CID 13430215
(1aS,7aR)-7a-phenyl-1aH-oxireno[2,3-b]chromen-7-one (PubChem CID 13430215) has the molecular formula C15H10O3 and a molecular weight of 238.24 g/mol. Its IUPAC name is (1aS,7aR)-7a-phenyl-1aH-oxireno[2,3-b]chromen-7-one.
| Compound Name | (1aS,7aR)-7a-phenyl-1aH-oxireno[2,3-b]chromen-7-one |
|---|---|
| PubChem CID | 13430215 |
| Molecular Formula | C15H10O3 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | (1aS,7aR)-7a-phenyl-1aH-oxireno[2,3-b]chromen-7-one |
| SMILES | O=C1c2ccccc2O[C@H]2O[C@@]12c1ccccc1 |
| InChI | InChI=1S/C15H10O3/c16-13-11-8-4-5-9-12(11)17-14-15(13,18-14)10-6-2-1-3-7-10/h1-9,14H/t14-,15-/m0/s1 |
| InChIKey | PPVMRVQMJLSRQG-GJZGRUSLSA-N |
| XLogP | 2.51 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|