C21H14BrO3- — CID 134840633
3-bromo-4-oxo-2,3-diphenylchromen-2-olate (PubChem CID 134840633) has the molecular formula C21H14BrO3- and a molecular weight of 394.24 g/mol. Its IUPAC name is 3-bromo-4-oxo-2,3-diphenylchromen-2-olate.
| Compound Name | 3-bromo-4-oxo-2,3-diphenylchromen-2-olate |
|---|---|
| PubChem CID | 134840633 |
| Molecular Formula | C21H14BrO3- |
| Molecular Weight | 394.24 g/mol |
| Exact Mass | 393.01 |
| IUPAC Name | 3-bromo-4-oxo-2,3-diphenylchromen-2-olate |
| SMILES | O=C1c2ccccc2OC([O-])(c2ccccc2)C1(Br)c1ccccc1 |
| InChI | InChI=1S/C21H14BrO3/c22-20(15-9-3-1-4-10-15)19(23)17-13-7-8-14-18(17)25-21(20,24)16-11-5-2-6-12-16/h1-14H/q-1 |
| InChIKey | MBXJSDOECVTSOH-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.24 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|