C10H4F6O2 — CID 13384251
2,2-bis(trifluoromethyl)-1-benzofuran-3-one (PubChem CID 13384251) has the molecular formula C10H4F6O2 and a molecular weight of 270.13 g/mol. Its IUPAC name is 2,2-bis(trifluoromethyl)-1-benzofuran-3-one.
| Compound Name | 2,2-bis(trifluoromethyl)-1-benzofuran-3-one |
|---|---|
| PubChem CID | 13384251 |
| Molecular Formula | C10H4F6O2 |
| Molecular Weight | 270.13 g/mol |
| Exact Mass | 270.01 |
| IUPAC Name | 2,2-bis(trifluoromethyl)-1-benzofuran-3-one |
| SMILES | O=C1c2ccccc2OC1(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H4F6O2/c11-9(12,13)8(10(14,15)16)7(17)5-3-1-2-4-6(5)18-8/h1-4H |
| InChIKey | QCMSWFIUGKYNHB-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.13 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |