C13H6F8O3 — CID 154448945
2-(1,1,2,2,2-pentafluoroethyl)-2-(trifluoromethyl)chromene-3-carboxylic acid (PubChem CID 154448945) has the molecular formula C13H6F8O3 and a molecular weight of 362.17 g/mol. Its IUPAC name is 2-(1,1,2,2,2-pentafluoroethyl)-2-(trifluoromethyl)chromene-3-carboxylic acid.
| Compound Name | 2-(1,1,2,2,2-pentafluoroethyl)-2-(trifluoromethyl)chromene-3-carboxylic acid |
|---|---|
| PubChem CID | 154448945 |
| Molecular Formula | C13H6F8O3 |
| Molecular Weight | 362.17 g/mol |
| Exact Mass | 362.02 |
| IUPAC Name | 2-(1,1,2,2,2-pentafluoroethyl)-2-(trifluoromethyl)chromene-3-carboxylic acid |
| SMILES | O=C(O)C1=Cc2ccccc2OC1(C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H6F8O3/c14-11(15,13(19,20)21)10(12(16,17)18)7(9(22)23)5-6-3-1-2-4-8(6)24-10/h1-5H,(H,22,23) |
| InChIKey | NHADPGOKTKILGO-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.17 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|