C14H13F3O5 — CID 99992703
(2S)-2-(2-methoxyethoxy)-2-(trifluoromethyl)chromene-3-carboxylic acid (PubChem CID 99992703) has the molecular formula C14H13F3O5 and a molecular weight of 318.25 g/mol. Its IUPAC name is (2S)-2-(2-methoxyethoxy)-2-(trifluoromethyl)chromene-3-carboxylic acid.
| Compound Name | (2S)-2-(2-methoxyethoxy)-2-(trifluoromethyl)chromene-3-carboxylic acid |
|---|---|
| PubChem CID | 99992703 |
| Molecular Formula | C14H13F3O5 |
| Molecular Weight | 318.25 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | (2S)-2-(2-methoxyethoxy)-2-(trifluoromethyl)chromene-3-carboxylic acid |
| SMILES | COCCO[C@]1(C(F)(F)F)Oc2ccccc2C=C1C(=O)O |
| InChI | InChI=1S/C14H13F3O5/c1-20-6-7-21-13(14(15,16)17)10(12(18)19)8-9-4-2-3-5-11(9)22-13/h2-5,8H,6-7H2,1H3,(H,18,19)/t13-/m0/s1 |
| InChIKey | ZZATXFCDROFZTC-ZDUSSCGKSA-N |
| XLogP | 2.47 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.25 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|