C16H18F3NO3 — CID 141097825
2-(3-methylbutylamino)-2-(trifluoromethyl)chromene-3-carboxylic acid (PubChem CID 141097825) has the molecular formula C16H18F3NO3 and a molecular weight of 329.32 g/mol. Its IUPAC name is 2-(3-methylbutylamino)-2-(trifluoromethyl)chromene-3-carboxylic acid.
| Compound Name | 2-(3-methylbutylamino)-2-(trifluoromethyl)chromene-3-carboxylic acid |
|---|---|
| PubChem CID | 141097825 |
| Molecular Formula | C16H18F3NO3 |
| Molecular Weight | 329.32 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 2-(3-methylbutylamino)-2-(trifluoromethyl)chromene-3-carboxylic acid |
| SMILES | CC(C)CCNC1(C(F)(F)F)Oc2ccccc2C=C1C(=O)O |
| InChI | InChI=1S/C16H18F3NO3/c1-10(2)7-8-20-15(16(17,18)19)12(14(21)22)9-11-5-3-4-6-13(11)23-15/h3-6,9-10,20H,7-8H2,1-2H3,(H,21,22) |
| InChIKey | PFMIHVYVKGBJOJ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.32 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |