C11H7F3O4S — CID 141098191
2-sulfanyloxy-2-(trifluoromethyl)chromene-3-carboxylic acid (PubChem CID 141098191) has the molecular formula C11H7F3O4S and a molecular weight of 292.23 g/mol. Its IUPAC name is 2-sulfanyloxy-2-(trifluoromethyl)chromene-3-carboxylic acid.
| Compound Name | 2-sulfanyloxy-2-(trifluoromethyl)chromene-3-carboxylic acid |
|---|---|
| PubChem CID | 141098191 |
| Molecular Formula | C11H7F3O4S |
| Molecular Weight | 292.23 g/mol |
| Exact Mass | 292.00 |
| IUPAC Name | 2-sulfanyloxy-2-(trifluoromethyl)chromene-3-carboxylic acid |
| SMILES | O=C(O)C1=Cc2ccccc2OC1(OS)C(F)(F)F |
| InChI | InChI=1S/C11H7F3O4S/c12-11(13,14)10(18-19)7(9(15)16)5-6-3-1-2-4-8(6)17-10/h1-5,19H,(H,15,16) |
| InChIKey | FHNKVQRGPCTUNR-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.23 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|