C18H13F3O3 — CID 142774329
2-(3-methylphenyl)-2-(trifluoromethyl)chromene-3-carboxylic acid (PubChem CID 142774329) has the molecular formula C18H13F3O3 and a molecular weight of 334.29 g/mol. Its IUPAC name is 2-(3-methylphenyl)-2-(trifluoromethyl)chromene-3-carboxylic acid.
| Compound Name | 2-(3-methylphenyl)-2-(trifluoromethyl)chromene-3-carboxylic acid |
|---|---|
| PubChem CID | 142774329 |
| Molecular Formula | C18H13F3O3 |
| Molecular Weight | 334.29 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | 2-(3-methylphenyl)-2-(trifluoromethyl)chromene-3-carboxylic acid |
| SMILES | Cc1cccc(C2(C(F)(F)F)Oc3ccccc3C=C2C(=O)O)c1 |
| InChI | InChI=1S/C18H13F3O3/c1-11-5-4-7-13(9-11)17(18(19,20)21)14(16(22)23)10-12-6-2-3-8-15(12)24-17/h2-10H,1H3,(H,22,23) |
| InChIKey | JFXYPPKQYSYTDU-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.29 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |