C18H10F6O4 — CID 141098076
2-phenyl-6-(trifluoromethoxy)-2-(trifluoromethyl)chromene-3-carboxylic acid (PubChem CID 141098076) has the molecular formula C18H10F6O4 and a molecular weight of 404.26 g/mol. Its IUPAC name is 2-phenyl-6-(trifluoromethoxy)-2-(trifluoromethyl)chromene-3-carboxylic acid.
| Compound Name | 2-phenyl-6-(trifluoromethoxy)-2-(trifluoromethyl)chromene-3-carboxylic acid |
|---|---|
| PubChem CID | 141098076 |
| Molecular Formula | C18H10F6O4 |
| Molecular Weight | 404.26 g/mol |
| Exact Mass | 404.05 |
| IUPAC Name | 2-phenyl-6-(trifluoromethoxy)-2-(trifluoromethyl)chromene-3-carboxylic acid |
| SMILES | O=C(O)C1=Cc2cc(OC(F)(F)F)ccc2OC1(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C18H10F6O4/c19-17(20,21)16(11-4-2-1-3-5-11)13(15(25)26)9-10-8-12(27-18(22,23)24)6-7-14(10)28-16/h1-9H,(H,25,26) |
| InChIKey | PMLQOIOOFLMRSQ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.26 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |