C17H11F3O4 — CID 142774321
2-(4-hydroxyphenyl)-2-(trifluoromethyl)chromene-3-carboxylic acid (PubChem CID 142774321) has the molecular formula C17H11F3O4 and a molecular weight of 336.26 g/mol. Its IUPAC name is 2-(4-hydroxyphenyl)-2-(trifluoromethyl)chromene-3-carboxylic acid.
| Compound Name | 2-(4-hydroxyphenyl)-2-(trifluoromethyl)chromene-3-carboxylic acid |
|---|---|
| PubChem CID | 142774321 |
| Molecular Formula | C17H11F3O4 |
| Molecular Weight | 336.26 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | 2-(4-hydroxyphenyl)-2-(trifluoromethyl)chromene-3-carboxylic acid |
| SMILES | O=C(O)C1=Cc2ccccc2OC1(c1ccc(O)cc1)C(F)(F)F |
| InChI | InChI=1S/C17H11F3O4/c18-17(19,20)16(11-5-7-12(21)8-6-11)13(15(22)23)9-10-3-1-2-4-14(10)24-16/h1-9,21H,(H,22,23) |
| InChIKey | VCMKIUYISHCXJG-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.26 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |