C9H6F2O2 — CID 156711266
3,3-difluoro-2H-chromen-4-one (PubChem CID 156711266) has the molecular formula C9H6F2O2 and a molecular weight of 184.14 g/mol. Its IUPAC name is 3,3-difluoro-2H-chromen-4-one.
| Compound Name | 3,3-difluoro-2H-chromen-4-one |
|---|---|
| PubChem CID | 156711266 |
| Molecular Formula | C9H6F2O2 |
| Molecular Weight | 184.14 g/mol |
| Exact Mass | 184.03 |
| IUPAC Name | 3,3-difluoro-2H-chromen-4-one |
| SMILES | O=C1c2ccccc2OCC1(F)F |
| InChI | InChI=1S/C9H6F2O2/c10-9(11)5-13-7-4-2-1-3-6(7)8(9)12/h1-4H,5H2 |
| InChIKey | OBFJWZPFCPOODU-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.14 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |