C10H8N2O2S — CID 168654955
spiro[2H-chromene-3,2'-3H-1,3,4-thiadiazole]-4-one (PubChem CID 168654955) has the molecular formula C10H8N2O2S and a molecular weight of 220.25 g/mol. Its IUPAC name is spiro[2H-chromene-3,2'-3H-1,3,4-thiadiazole]-4-one.
| Compound Name | spiro[2H-chromene-3,2'-3H-1,3,4-thiadiazole]-4-one |
|---|---|
| PubChem CID | 168654955 |
| Molecular Formula | C10H8N2O2S |
| Molecular Weight | 220.25 g/mol |
| Exact Mass | 220.03 |
| IUPAC Name | spiro[2H-chromene-3,2'-3H-1,3,4-thiadiazole]-4-one |
| SMILES | O=C1c2ccccc2OCC12NN=CS2 |
| InChI | InChI=1S/C10H8N2O2S/c13-9-7-3-1-2-4-8(7)14-5-10(9)12-11-6-15-10/h1-4,6,12H,5H2 |
| InChIKey | JQUGPROLCRCMHJ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.25 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |