C12H13NO2 — CID 10987336
(3R,3'S)-3'-ethylspiro[2H-chromene-3,2'-aziridine]-4-one (PubChem CID 10987336) has the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. Its IUPAC name is (3R,3'S)-3'-ethylspiro[2H-chromene-3,2'-aziridine]-4-one.
| Compound Name | (3R,3'S)-3'-ethylspiro[2H-chromene-3,2'-aziridine]-4-one |
|---|---|
| PubChem CID | 10987336 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | (3R,3'S)-3'-ethylspiro[2H-chromene-3,2'-aziridine]-4-one |
| SMILES | CC[C@@H]1N[C@@]12COc1ccccc1C2=O |
| InChI | InChI=1S/C12H13NO2/c1-2-10-12(13-10)7-15-9-6-4-3-5-8(9)11(12)14/h3-6,10,13H,2,7H2,1H3/t10-,12-/m0/s1 |
| InChIKey | QPCXVDXDKCMQRN-JQWIXIFHSA-N |
| XLogP | 1.38 |
| TPSA | 48.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|