C17H14O2 — CID 7084615
(2'S,3R)-2'-phenylspiro[2H-chromene-3,1'-cyclopropane]-4-one (PubChem CID 7084615) has the molecular formula C17H14O2 and a molecular weight of 250.30 g/mol. Its IUPAC name is (2'S,3R)-2'-phenylspiro[2H-chromene-3,1'-cyclopropane]-4-one.
| Compound Name | (2'S,3R)-2'-phenylspiro[2H-chromene-3,1'-cyclopropane]-4-one |
|---|---|
| PubChem CID | 7084615 |
| Molecular Formula | C17H14O2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | (2'S,3R)-2'-phenylspiro[2H-chromene-3,1'-cyclopropane]-4-one |
| SMILES | O=C1c2ccccc2OC[C@]12C[C@H]2c1ccccc1 |
| InChI | InChI=1S/C17H14O2/c18-16-13-8-4-5-9-15(13)19-11-17(16)10-14(17)12-6-2-1-3-7-12/h1-9,14H,10-11H2/t14-,17-/m0/s1 |
| InChIKey | AWXJBGPSGPZWGA-YOEHRIQHSA-N |
| XLogP | 3.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |