C17H12O3 — CID 91465607
9a-phenyl-2H-furo[2,3-b]chromen-4-one (PubChem CID 91465607) has the molecular formula C17H12O3 and a molecular weight of 264.28 g/mol. Its IUPAC name is 9a-phenyl-2H-furo[2,3-b]chromen-4-one.
| Compound Name | 9a-phenyl-2H-furo[2,3-b]chromen-4-one |
|---|---|
| PubChem CID | 91465607 |
| Molecular Formula | C17H12O3 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | 9a-phenyl-2H-furo[2,3-b]chromen-4-one |
| SMILES | O=C1C2=CCOC2(c2ccccc2)Oc2ccccc21 |
| InChI | InChI=1S/C17H12O3/c18-16-13-8-4-5-9-15(13)20-17(14(16)10-11-19-17)12-6-2-1-3-7-12/h1-10H,11H2 |
| InChIKey | XCBBJXZGVCDXFS-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |