C18H12O4 — CID 139091694
(12aR)-12a-methoxybenzo[c]xanthene-5,7-dione (PubChem CID 139091694) has the molecular formula C18H12O4 and a molecular weight of 292.29 g/mol. Its IUPAC name is (12aR)-12a-methoxybenzo[c]xanthene-5,7-dione.
| Compound Name | (12aR)-12a-methoxybenzo[c]xanthene-5,7-dione |
|---|---|
| PubChem CID | 139091694 |
| Molecular Formula | C18H12O4 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | (12aR)-12a-methoxybenzo[c]xanthene-5,7-dione |
| SMILES | CO[C@]12Oc3ccccc3C(=O)C1=CC(=O)c1ccccc12 |
| InChI | InChI=1S/C18H12O4/c1-21-18-13-8-4-2-6-11(13)15(19)10-14(18)17(20)12-7-3-5-9-16(12)22-18/h2-10H,1H3/t18-/m1/s1 |
| InChIKey | ACIDTYPTQNCKPQ-GOSISDBHSA-N |
| XLogP | 2.88 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |