C13H12Cl2O2S — CID 10756814
(3-chloro-4-oxospiro[chromene-2,1'-cyclopentane]-3-yl) thiohypochlorite (PubChem CID 10756814) has the molecular formula C13H12Cl2O2S and a molecular weight of 303.21 g/mol. Its IUPAC name is (3-chloro-4-oxospiro[chromene-2,1'-cyclopentane]-3-yl) thiohypochlorite.
| Compound Name | (3-chloro-4-oxospiro[chromene-2,1'-cyclopentane]-3-yl) thiohypochlorite |
|---|---|
| PubChem CID | 10756814 |
| Molecular Formula | C13H12Cl2O2S |
| Molecular Weight | 303.21 g/mol |
| Exact Mass | 301.99 |
| IUPAC Name | (3-chloro-4-oxospiro[chromene-2,1'-cyclopentane]-3-yl) thiohypochlorite |
| SMILES | O=C1c2ccccc2OC2(CCCC2)C1(Cl)SCl |
| InChI | InChI=1S/C13H12Cl2O2S/c14-13(18-15)11(16)9-5-1-2-6-10(9)17-12(13)7-3-4-8-12/h1-2,5-6H,3-4,7-8H2 |
| InChIKey | CYNDBDBRCSNQTE-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.21 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|