C21H21ClO4S2 — CID 11837042
3-chloro-3-(4-methylphenyl)sulfonylsulfanylspiro[chromene-2,1'-cyclohexane]-4-one (PubChem CID 11837042) has the molecular formula C21H21ClO4S2 and a molecular weight of 436.98 g/mol. Its IUPAC name is 3-chloro-3-(4-methylphenyl)sulfonylsulfanylspiro[chromene-2,1'-cyclohexane]-4-one.
| Compound Name | 3-chloro-3-(4-methylphenyl)sulfonylsulfanylspiro[chromene-2,1'-cyclohexane]-4-one |
|---|---|
| PubChem CID | 11837042 |
| Molecular Formula | C21H21ClO4S2 |
| Molecular Weight | 436.98 g/mol |
| Exact Mass | 436.06 |
| IUPAC Name | 3-chloro-3-(4-methylphenyl)sulfonylsulfanylspiro[chromene-2,1'-cyclohexane]-4-one |
| SMILES | Cc1ccc(S(=O)(=O)SC2(Cl)C(=O)c3ccccc3OC23CCCCC3)cc1 |
| InChI | InChI=1S/C21H21ClO4S2/c1-15-9-11-16(12-10-15)28(24,25)27-21(22)19(23)17-7-3-4-8-18(17)26-20(21)13-5-2-6-14-20/h3-4,7-12H,2,5-6,13-14H2,1H3 |
| InChIKey | ZHFRDYKLEQVEET-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.98 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|