C17H24O4S — CID 11652739
(1R)-1-[(2S)-2-(4-methylphenyl)sulfonyl-1-oxaspiro[2.5]octan-2-yl]propan-1-ol (PubChem CID 11652739) has the molecular formula C17H24O4S and a molecular weight of 324.44 g/mol. Its IUPAC name is (1R)-1-[(2S)-2-(4-methylphenyl)sulfonyl-1-oxaspiro[2.5]octan-2-yl]propan-1-ol.
| Compound Name | (1R)-1-[(2S)-2-(4-methylphenyl)sulfonyl-1-oxaspiro[2.5]octan-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 11652739 |
| Molecular Formula | C17H24O4S |
| Molecular Weight | 324.44 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | (1R)-1-[(2S)-2-(4-methylphenyl)sulfonyl-1-oxaspiro[2.5]octan-2-yl]propan-1-ol |
| SMILES | CC[C@@H](O)[C@@]1(S(=O)(=O)c2ccc(C)cc2)OC12CCCCC2 |
| InChI | InChI=1S/C17H24O4S/c1-3-15(18)17(16(21-17)11-5-4-6-12-16)22(19,20)14-9-7-13(2)8-10-14/h7-10,15,18H,3-6,11-12H2,1-2H3/t15-,17+/m1/s1 |
| InChIKey | ZQGJUOVNQGFUGT-WBVHZDCISA-N |
| XLogP | 2.97 |
| TPSA | 66.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.44 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|