C15H15ClO3S2 — CID 10736121
S-(3-chloro-4-oxospiro[chromene-2,1'-cyclopentane]-3-yl)sulfanyl ethanethioate (PubChem CID 10736121) has the molecular formula C15H15ClO3S2 and a molecular weight of 342.87 g/mol. Its IUPAC name is S-(3-chloro-4-oxospiro[chromene-2,1'-cyclopentane]-3-yl)sulfanyl ethanethioate.
| Compound Name | S-(3-chloro-4-oxospiro[chromene-2,1'-cyclopentane]-3-yl)sulfanyl ethanethioate |
|---|---|
| PubChem CID | 10736121 |
| Molecular Formula | C15H15ClO3S2 |
| Molecular Weight | 342.87 g/mol |
| Exact Mass | 342.02 |
| IUPAC Name | S-(3-chloro-4-oxospiro[chromene-2,1'-cyclopentane]-3-yl)sulfanyl ethanethioate |
| SMILES | CC(=O)SSC1(Cl)C(=O)c2ccccc2OC12CCCC2 |
| InChI | InChI=1S/C15H15ClO3S2/c1-10(17)20-21-15(16)13(18)11-6-2-3-7-12(11)19-14(15)8-4-5-9-14/h2-3,6-7H,4-5,8-9H2,1H3 |
| InChIKey | PMMCPJJPZIUSAY-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.87 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|