C16H17BrO4S — CID 18385950
3-bromo-2-(4-methylsulfonylphenyl)-1-oxaspiro[4.5]dec-2-en-4-one (PubChem CID 18385950) has the molecular formula C16H17BrO4S and a molecular weight of 385.28 g/mol. Its IUPAC name is 3-bromo-2-(4-methylsulfonylphenyl)-1-oxaspiro[4.5]dec-2-en-4-one.
| Compound Name | 3-bromo-2-(4-methylsulfonylphenyl)-1-oxaspiro[4.5]dec-2-en-4-one |
|---|---|
| PubChem CID | 18385950 |
| Molecular Formula | C16H17BrO4S |
| Molecular Weight | 385.28 g/mol |
| Exact Mass | 384.00 |
| IUPAC Name | 3-bromo-2-(4-methylsulfonylphenyl)-1-oxaspiro[4.5]dec-2-en-4-one |
| SMILES | CS(=O)(=O)c1ccc(C2=C(Br)C(=O)C3(CCCCC3)O2)cc1 |
| InChI | InChI=1S/C16H17BrO4S/c1-22(19,20)12-7-5-11(6-8-12)14-13(17)15(18)16(21-14)9-3-2-4-10-16/h5-8H,2-4,9-10H2,1H3 |
| InChIKey | XWLVKJIFSBHYLC-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.28 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|