About 4-(cyclopropylmethoxy)-2,2-dimethyl-5-(4-methylsulfonylphenyl)furan-3-one
4-(cyclopropylmethoxy)-2,2-dimethyl-5-(4-methylsulfonylphenyl)furan-3-one (PubChem CID 139415586) has the molecular formula C17H20O5S
and a molecular weight of 336.41 g/mol. Its IUPAC name is 4-(cyclopropylmethoxy)-2,2-dimethyl-5-(4-methylsulfonylphenyl)furan-3-one.
Molecular Properties
| Compound Name | 4-(cyclopropylmethoxy)-2,2-dimethyl-5-(4-methylsulfonylphenyl)furan-3-one |
| PubChem CID | 139415586 |
| Molecular Formula | C17H20O5S |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | 4-(cyclopropylmethoxy)-2,2-dimethyl-5-(4-methylsulfonylphenyl)furan-3-one |
| SMILES | CC1(C)OC(c2ccc(S(C)(=O)=O)cc2)=C(OCC2CC2)C1=O |
| InChI | InChI=1S/C17H20O5S/c1-17(2)16(18)15(21-10-11-4-5-11)14(22-17)12-6-8-13(9-7-12)23(3,19)20/h6-9,11H,4-5,10H2,1-3H3 |
| InChIKey | VGKSBYMZACNBLG-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(cyclopropylmethoxy)-2,2-dimethyl-5-(4-methylsulfonylphenyl)furan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(cyclopropylmethoxy)-2,2-dimethyl-5-(4-methylsulfonylphenyl)furan-3-one?
The IUPAC name of 4-(cyclopropylmethoxy)-2,2-dimethyl-5-(4-methylsulfonylphenyl)furan-3-one (CID 139415586) is 4-(cyclopropylmethoxy)-2,2-dimethyl-5-(4-methylsulfonylphenyl)furan-3-one.
What is the SMILES notation for 4-(cyclopropylmethoxy)-2,2-dimethyl-5-(4-methylsulfonylphenyl)furan-3-one?
The canonical SMILES for 4-(cyclopropylmethoxy)-2,2-dimethyl-5-(4-methylsulfonylphenyl)furan-3-one is CC1(C)OC(c2ccc(S(C)(=O)=O)cc2)=C(OCC2CC2)C1=O.
What is the InChIKey of 4-(cyclopropylmethoxy)-2,2-dimethyl-5-(4-methylsulfonylphenyl)furan-3-one?
The InChIKey is VGKSBYMZACNBLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20O5S/c1-17(2)16(18)15(21-10-11-4-5-11)14(22-17)12-6-8-13(9-7-12)23(3,19)20/h6-9,11H,4-5,10H2,1-3H3.
What are the key properties of 4-(cyclopropylmethoxy)-2,2-dimethyl-5-(4-methylsulfonylphenyl)furan-3-one?
4-(cyclopropylmethoxy)-2,2-dimethyl-5-(4-methylsulfonylphenyl)furan-3-one has a molecular weight of 336.41 g/mol, XLogP of 2.56, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(cyclopropylmethoxy)-2,2-dimethyl-5-(4-methylsulfonylphenyl)furan-3-one is sourced from PubChem (CID 139415586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).