C17H22O5S — CID 91285555
2-(cyclopropylmethoxy)-5,5-dimethyl-4-(4-methylsulfonylphenyl)furan-2-ol (PubChem CID 91285555) has the molecular formula C17H22O5S and a molecular weight of 338.43 g/mol. Its IUPAC name is 2-(cyclopropylmethoxy)-5,5-dimethyl-4-(4-methylsulfonylphenyl)furan-2-ol.
| Compound Name | 2-(cyclopropylmethoxy)-5,5-dimethyl-4-(4-methylsulfonylphenyl)furan-2-ol |
|---|---|
| PubChem CID | 91285555 |
| Molecular Formula | C17H22O5S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 2-(cyclopropylmethoxy)-5,5-dimethyl-4-(4-methylsulfonylphenyl)furan-2-ol |
| SMILES | CC1(C)OC(O)(OCC2CC2)C=C1c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C17H22O5S/c1-16(2)15(10-17(18,22-16)21-11-12-4-5-12)13-6-8-14(9-7-13)23(3,19)20/h6-10,12,18H,4-5,11H2,1-3H3 |
| InChIKey | PGXZSOXTPLSOTP-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|