C26H35NO4S — CID 90018618
1-[[4-[[4-(4-methylsulfonylphenyl)phenoxy]methyl]piperidin-1-yl]methyl]cyclohexan-1-ol (PubChem CID 90018618) has the molecular formula C26H35NO4S and a molecular weight of 457.64 g/mol. Its IUPAC name is 1-[[4-[[4-(4-methylsulfonylphenyl)phenoxy]methyl]piperidin-1-yl]methyl]cyclohexan-1-ol.
| Compound Name | 1-[[4-[[4-(4-methylsulfonylphenyl)phenoxy]methyl]piperidin-1-yl]methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 90018618 |
| Molecular Formula | C26H35NO4S |
| Molecular Weight | 457.64 g/mol |
| Exact Mass | 457.23 |
| IUPAC Name | 1-[[4-[[4-(4-methylsulfonylphenyl)phenoxy]methyl]piperidin-1-yl]methyl]cyclohexan-1-ol |
| SMILES | CS(=O)(=O)c1ccc(-c2ccc(OCC3CCN(CC4(O)CCCCC4)CC3)cc2)cc1 |
| InChI | InChI=1S/C26H35NO4S/c1-32(29,30)25-11-7-23(8-12-25)22-5-9-24(10-6-22)31-19-21-13-17-27(18-14-21)20-26(28)15-3-2-4-16-26/h5-12,21,28H,2-4,13-20H2,1H3 |
| InChIKey | XRMVQSPLXPVTJJ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.64 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |