C19H24N4O4S — CID 87100228
N'-hydroxy-4-[[6-(4-methylsulfonylphenyl)-3-pyridinyl]oxymethyl]piperidine-1-carboximidamide (PubChem CID 87100228) has the molecular formula C19H24N4O4S and a molecular weight of 404.49 g/mol. Its IUPAC name is N'-hydroxy-4-[[6-(4-methylsulfonylphenyl)-3-pyridinyl]oxymethyl]piperidine-1-carboximidamide.
| Compound Name | N'-hydroxy-4-[[6-(4-methylsulfonylphenyl)-3-pyridinyl]oxymethyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 87100228 |
| Molecular Formula | C19H24N4O4S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | N'-hydroxy-4-[[6-(4-methylsulfonylphenyl)-3-pyridinyl]oxymethyl]piperidine-1-carboximidamide |
| SMILES | CS(=O)(=O)c1ccc(-c2ccc(OCC3CCN(/C(N)=N/O)CC3)cn2)cc1 |
| InChI | InChI=1S/C19H24N4O4S/c1-28(25,26)17-5-2-15(3-6-17)18-7-4-16(12-21-18)27-13-14-8-10-23(11-9-14)19(20)22-24/h2-7,12,14,24H,8-11,13H2,1H3,(H2,20,22) |
| InChIKey | VPGHZXNHJNMETC-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 118.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|