C18H25N3O5S — CID 174917187
4-(hydroxyamino)-4-methyl-5-(4-methylsulfonylphenyl)-2-(oxan-4-ylmethyl)-3H-pyrazole-3-carbaldehyde (PubChem CID 174917187) has the molecular formula C18H25N3O5S and a molecular weight of 395.48 g/mol. Its IUPAC name is 4-(hydroxyamino)-4-methyl-5-(4-methylsulfonylphenyl)-2-(oxan-4-ylmethyl)-3H-pyrazole-3-carbaldehyde.
| Compound Name | 4-(hydroxyamino)-4-methyl-5-(4-methylsulfonylphenyl)-2-(oxan-4-ylmethyl)-3H-pyrazole-3-carbaldehyde |
|---|---|
| PubChem CID | 174917187 |
| Molecular Formula | C18H25N3O5S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | 4-(hydroxyamino)-4-methyl-5-(4-methylsulfonylphenyl)-2-(oxan-4-ylmethyl)-3H-pyrazole-3-carbaldehyde |
| SMILES | CC1(NO)C(c2ccc(S(C)(=O)=O)cc2)=NN(CC2CCOCC2)C1C=O |
| InChI | InChI=1S/C18H25N3O5S/c1-18(20-23)16(12-22)21(11-13-7-9-26-10-8-13)19-17(18)14-3-5-15(6-4-14)27(2,24)25/h3-6,12-13,16,20,23H,7-11H2,1-2H3 |
| InChIKey | CPJZIGZQCXEFQG-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 108.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|