C15H21NO5S2 — CID 39697581
N-cyclopropyl-4-methylsulfonyl-N-[[(3R)-oxolan-3-yl]methyl]benzenesulfonamide (PubChem CID 39697581) has the molecular formula C15H21NO5S2 and a molecular weight of 359.47 g/mol. Its IUPAC name is N-cyclopropyl-4-methylsulfonyl-N-[[(3R)-oxolan-3-yl]methyl]benzenesulfonamide.
| Compound Name | N-cyclopropyl-4-methylsulfonyl-N-[[(3R)-oxolan-3-yl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 39697581 |
| Molecular Formula | C15H21NO5S2 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | N-cyclopropyl-4-methylsulfonyl-N-[[(3R)-oxolan-3-yl]methyl]benzenesulfonamide |
| SMILES | CS(=O)(=O)c1ccc(S(=O)(=O)N(C[C@H]2CCOC2)C2CC2)cc1 |
| InChI | InChI=1S/C15H21NO5S2/c1-22(17,18)14-4-6-15(7-5-14)23(19,20)16(13-2-3-13)10-12-8-9-21-11-12/h4-7,12-13H,2-3,8-11H2,1H3/t12-/m1/s1 |
| InChIKey | LGPIJFRTTNQWHS-GFCCVEGCSA-N |
| XLogP | 1.28 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |