C15H20FNO4S — CID 39697628
N-cyclopropyl-3-fluoro-4-methoxy-N-[[(3R)-oxolan-3-yl]methyl]benzenesulfonamide (PubChem CID 39697628) has the molecular formula C15H20FNO4S and a molecular weight of 329.39 g/mol. Its IUPAC name is N-cyclopropyl-3-fluoro-4-methoxy-N-[[(3R)-oxolan-3-yl]methyl]benzenesulfonamide.
| Compound Name | N-cyclopropyl-3-fluoro-4-methoxy-N-[[(3R)-oxolan-3-yl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 39697628 |
| Molecular Formula | C15H20FNO4S |
| Molecular Weight | 329.39 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | N-cyclopropyl-3-fluoro-4-methoxy-N-[[(3R)-oxolan-3-yl]methyl]benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)N(C[C@H]2CCOC2)C2CC2)cc1F |
| InChI | InChI=1S/C15H20FNO4S/c1-20-15-5-4-13(8-14(15)16)22(18,19)17(12-2-3-12)9-11-6-7-21-10-11/h4-5,8,11-12H,2-3,6-7,9-10H2,1H3/t11-/m1/s1 |
| InChIKey | VQBUCOMUFRDYKM-LLVKDONJSA-N |
| XLogP | 2.02 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.39 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |