C15H22FNO4S — CID 91915442
5-fluoro-2-methoxy-N-(oxolan-3-ylmethyl)-N-propylbenzenesulfonamide (PubChem CID 91915442) has the molecular formula C15H22FNO4S and a molecular weight of 331.41 g/mol. Its IUPAC name is 5-fluoro-2-methoxy-N-(oxolan-3-ylmethyl)-N-propylbenzenesulfonamide.
| Compound Name | 5-fluoro-2-methoxy-N-(oxolan-3-ylmethyl)-N-propylbenzenesulfonamide |
|---|---|
| PubChem CID | 91915442 |
| Molecular Formula | C15H22FNO4S |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | 5-fluoro-2-methoxy-N-(oxolan-3-ylmethyl)-N-propylbenzenesulfonamide |
| SMILES | CCCN(CC1CCOC1)S(=O)(=O)c1cc(F)ccc1OC |
| InChI | InChI=1S/C15H22FNO4S/c1-3-7-17(10-12-6-8-21-11-12)22(18,19)15-9-13(16)4-5-14(15)20-2/h4-5,9,12H,3,6-8,10-11H2,1-2H3 |
| InChIKey | YTVCNFYRXSJSLC-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |