C15H22FNO3S — CID 99767674
1-(2-fluorophenyl)-N-[[(3R)-oxolan-3-yl]methyl]-N-propylmethanesulfonamide (PubChem CID 99767674) has the molecular formula C15H22FNO3S and a molecular weight of 315.41 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-N-[[(3R)-oxolan-3-yl]methyl]-N-propylmethanesulfonamide.
| Compound Name | 1-(2-fluorophenyl)-N-[[(3R)-oxolan-3-yl]methyl]-N-propylmethanesulfonamide |
|---|---|
| PubChem CID | 99767674 |
| Molecular Formula | C15H22FNO3S |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | 1-(2-fluorophenyl)-N-[[(3R)-oxolan-3-yl]methyl]-N-propylmethanesulfonamide |
| SMILES | CCCN(C[C@H]1CCOC1)S(=O)(=O)Cc1ccccc1F |
| InChI | InChI=1S/C15H22FNO3S/c1-2-8-17(10-13-7-9-20-11-13)21(18,19)12-14-5-3-4-6-15(14)16/h3-6,13H,2,7-12H2,1H3/t13-/m1/s1 |
| InChIKey | PFNGTHGTGPOTFS-CYBMUJFWSA-N |
| XLogP | 2.40 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |