C15H22ClNO3S — CID 91915414
1-(2-chlorophenyl)-N-(oxolan-3-ylmethyl)-N-propylmethanesulfonamide (PubChem CID 91915414) has the molecular formula C15H22ClNO3S and a molecular weight of 331.86 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-N-(oxolan-3-ylmethyl)-N-propylmethanesulfonamide.
| Compound Name | 1-(2-chlorophenyl)-N-(oxolan-3-ylmethyl)-N-propylmethanesulfonamide |
|---|---|
| PubChem CID | 91915414 |
| Molecular Formula | C15H22ClNO3S |
| Molecular Weight | 331.86 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | 1-(2-chlorophenyl)-N-(oxolan-3-ylmethyl)-N-propylmethanesulfonamide |
| SMILES | CCCN(CC1CCOC1)S(=O)(=O)Cc1ccccc1Cl |
| InChI | InChI=1S/C15H22ClNO3S/c1-2-8-17(10-13-7-9-20-11-13)21(18,19)12-14-5-3-4-6-15(14)16/h3-6,13H,2,7-12H2,1H3 |
| InChIKey | OSJGIBXKCDTMFI-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.86 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |