C13H14ClN3O2S — CID 17257633
1-(2-chlorophenyl)-N,N-bis(2-cyanoethyl)methanesulfonamide (PubChem CID 17257633) has the molecular formula C13H14ClN3O2S and a molecular weight of 311.79 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-N,N-bis(2-cyanoethyl)methanesulfonamide.
| Compound Name | 1-(2-chlorophenyl)-N,N-bis(2-cyanoethyl)methanesulfonamide |
|---|---|
| PubChem CID | 17257633 |
| Molecular Formula | C13H14ClN3O2S |
| Molecular Weight | 311.79 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | 1-(2-chlorophenyl)-N,N-bis(2-cyanoethyl)methanesulfonamide |
| SMILES | N#CCCN(CCC#N)S(=O)(=O)Cc1ccccc1Cl |
| InChI | InChI=1S/C13H14ClN3O2S/c14-13-6-2-1-5-12(13)11-20(18,19)17(9-3-7-15)10-4-8-16/h1-2,5-6H,3-4,9-11H2 |
| InChIKey | VWJLLEKUAIIUAD-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 84.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.79 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |