C15H22ClNO4S — CID 95142044
1-(5-chloro-2-methoxyphenyl)-N-ethyl-N-[[(3S)-oxolan-3-yl]methyl]methanesulfonamide (PubChem CID 95142044) has the molecular formula C15H22ClNO4S and a molecular weight of 347.86 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxyphenyl)-N-ethyl-N-[[(3S)-oxolan-3-yl]methyl]methanesulfonamide.
| Compound Name | 1-(5-chloro-2-methoxyphenyl)-N-ethyl-N-[[(3S)-oxolan-3-yl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 95142044 |
| Molecular Formula | C15H22ClNO4S |
| Molecular Weight | 347.86 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | 1-(5-chloro-2-methoxyphenyl)-N-ethyl-N-[[(3S)-oxolan-3-yl]methyl]methanesulfonamide |
| SMILES | CCN(C[C@@H]1CCOC1)S(=O)(=O)Cc1cc(Cl)ccc1OC |
| InChI | InChI=1S/C15H22ClNO4S/c1-3-17(9-12-6-7-21-10-12)22(18,19)11-13-8-14(16)4-5-15(13)20-2/h4-5,8,12H,3,6-7,9-11H2,1-2H3/t12-/m0/s1 |
| InChIKey | HVYPUKILMOTTDW-LBPRGKRZSA-N |
| XLogP | 2.54 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.86 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |