C11H14FNO4S — CID 62104424
5-fluoro-2-(oxolan-3-ylmethoxy)benzenesulfonamide (PubChem CID 62104424) has the molecular formula C11H14FNO4S and a molecular weight of 275.30 g/mol. Its IUPAC name is 5-fluoro-2-(oxolan-3-ylmethoxy)benzenesulfonamide.
| Compound Name | 5-fluoro-2-(oxolan-3-ylmethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 62104424 |
| Molecular Formula | C11H14FNO4S |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | 5-fluoro-2-(oxolan-3-ylmethoxy)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cc(F)ccc1OCC1CCOC1 |
| InChI | InChI=1S/C11H14FNO4S/c12-9-1-2-10(11(5-9)18(13,14)15)17-7-8-3-4-16-6-8/h1-2,5,8H,3-4,6-7H2,(H2,13,14,15) |
| InChIKey | VFECUSMUJIUQGY-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |