C14H22Cl2N2O4S — CID 120706793
N-(3-aminopropyl)-5-chloro-2-(oxolan-3-ylmethoxy)benzenesulfonamide;hydrochloride (PubChem CID 120706793) has the molecular formula C14H22Cl2N2O4S and a molecular weight of 385.31 g/mol. Its IUPAC name is N-(3-aminopropyl)-5-chloro-2-(oxolan-3-ylmethoxy)benzenesulfonamide;hydrochloride.
| Compound Name | N-(3-aminopropyl)-5-chloro-2-(oxolan-3-ylmethoxy)benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120706793 |
| Molecular Formula | C14H22Cl2N2O4S |
| Molecular Weight | 385.31 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | N-(3-aminopropyl)-5-chloro-2-(oxolan-3-ylmethoxy)benzenesulfonamide;hydrochloride |
| SMILES | Cl.NCCCNS(=O)(=O)c1cc(Cl)ccc1OCC1CCOC1 |
| InChI | InChI=1S/C14H21ClN2O4S.ClH/c15-12-2-3-13(21-10-11-4-7-20-9-11)14(8-12)22(18,19)17-6-1-5-16;/h2-3,8,11,17H,1,4-7,9-10,16H2;1H |
| InChIKey | DULBDSWUZRNKTP-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.31 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|