C19H23FN2O4S — CID 120715810
N-[2-(4-aminophenyl)ethyl]-3-fluoro-4-(oxolan-3-ylmethoxy)benzenesulfonamide (PubChem CID 120715810) has the molecular formula C19H23FN2O4S and a molecular weight of 394.47 g/mol. Its IUPAC name is N-[2-(4-aminophenyl)ethyl]-3-fluoro-4-(oxolan-3-ylmethoxy)benzenesulfonamide.
| Compound Name | N-[2-(4-aminophenyl)ethyl]-3-fluoro-4-(oxolan-3-ylmethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 120715810 |
| Molecular Formula | C19H23FN2O4S |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | N-[2-(4-aminophenyl)ethyl]-3-fluoro-4-(oxolan-3-ylmethoxy)benzenesulfonamide |
| SMILES | Nc1ccc(CCNS(=O)(=O)c2ccc(OCC3CCOC3)c(F)c2)cc1 |
| InChI | InChI=1S/C19H23FN2O4S/c20-18-11-17(5-6-19(18)26-13-15-8-10-25-12-15)27(23,24)22-9-7-14-1-3-16(21)4-2-14/h1-6,11,15,22H,7-10,12-13,21H2 |
| InChIKey | ZTQWVIXHFNVYMZ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|