C12H15F2NO3S — CID 102554956
2,5-difluoro-N-methyl-N-(oxolan-3-ylmethyl)benzenesulfonamide (PubChem CID 102554956) has the molecular formula C12H15F2NO3S and a molecular weight of 291.32 g/mol. Its IUPAC name is 2,5-difluoro-N-methyl-N-(oxolan-3-ylmethyl)benzenesulfonamide.
| Compound Name | 2,5-difluoro-N-methyl-N-(oxolan-3-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 102554956 |
| Molecular Formula | C12H15F2NO3S |
| Molecular Weight | 291.32 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 2,5-difluoro-N-methyl-N-(oxolan-3-ylmethyl)benzenesulfonamide |
| SMILES | CN(CC1CCOC1)S(=O)(=O)c1cc(F)ccc1F |
| InChI | InChI=1S/C12H15F2NO3S/c1-15(7-9-4-5-18-8-9)19(16,17)12-6-10(13)2-3-11(12)14/h2-3,6,9H,4-5,7-8H2,1H3 |
| InChIKey | JGWZWYGJALZJLI-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.32 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |