C13H17F2NO3S — CID 91905238
3,4-difluoro-N-methyl-N-(oxan-4-ylmethyl)benzenesulfonamide (PubChem CID 91905238) has the molecular formula C13H17F2NO3S and a molecular weight of 305.35 g/mol. Its IUPAC name is 3,4-difluoro-N-methyl-N-(oxan-4-ylmethyl)benzenesulfonamide.
| Compound Name | 3,4-difluoro-N-methyl-N-(oxan-4-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 91905238 |
| Molecular Formula | C13H17F2NO3S |
| Molecular Weight | 305.35 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 3,4-difluoro-N-methyl-N-(oxan-4-ylmethyl)benzenesulfonamide |
| SMILES | CN(CC1CCOCC1)S(=O)(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C13H17F2NO3S/c1-16(9-10-4-6-19-7-5-10)20(17,18)11-2-3-12(14)13(15)8-11/h2-3,8,10H,4-7,9H2,1H3 |
| InChIKey | CSYBDSDWQMDBOD-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.35 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |