C15H20N2O6S — CID 39697483
N-cyclopropyl-2-methoxy-5-nitro-N-[[(3S)-oxolan-3-yl]methyl]benzenesulfonamide (PubChem CID 39697483) has the molecular formula C15H20N2O6S and a molecular weight of 356.40 g/mol. Its IUPAC name is N-cyclopropyl-2-methoxy-5-nitro-N-[[(3S)-oxolan-3-yl]methyl]benzenesulfonamide.
| Compound Name | N-cyclopropyl-2-methoxy-5-nitro-N-[[(3S)-oxolan-3-yl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 39697483 |
| Molecular Formula | C15H20N2O6S |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | N-cyclopropyl-2-methoxy-5-nitro-N-[[(3S)-oxolan-3-yl]methyl]benzenesulfonamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1S(=O)(=O)N(C[C@@H]1CCOC1)C1CC1 |
| InChI | InChI=1S/C15H20N2O6S/c1-22-14-5-4-13(17(18)19)8-15(14)24(20,21)16(12-2-3-12)9-11-6-7-23-10-11/h4-5,8,11-12H,2-3,6-7,9-10H2,1H3/t11-/m0/s1 |
| InChIKey | VUKZUITUVFCYJL-NSHDSACASA-N |
| XLogP | 1.79 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|