C14H20N2O5S — CID 39635425
N-cyclopropyl-2-methoxy-N-(2-methylpropyl)-4-nitrobenzenesulfonamide (PubChem CID 39635425) has the molecular formula C14H20N2O5S and a molecular weight of 328.39 g/mol. Its IUPAC name is N-cyclopropyl-2-methoxy-N-(2-methylpropyl)-4-nitrobenzenesulfonamide.
| Compound Name | N-cyclopropyl-2-methoxy-N-(2-methylpropyl)-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 39635425 |
| Molecular Formula | C14H20N2O5S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | N-cyclopropyl-2-methoxy-N-(2-methylpropyl)-4-nitrobenzenesulfonamide |
| SMILES | COc1cc([N+](=O)[O-])ccc1S(=O)(=O)N(CC(C)C)C1CC1 |
| InChI | InChI=1S/C14H20N2O5S/c1-10(2)9-15(11-4-5-11)22(19,20)14-7-6-12(16(17)18)8-13(14)21-3/h6-8,10-11H,4-5,9H2,1-3H3 |
| InChIKey | IFHAFPPJLDMXOT-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|