C9H11NO6S — CID 172600359
2-(2-methoxy-4-nitrophenyl)sulfonylethanol (PubChem CID 172600359) has the molecular formula C9H11NO6S and a molecular weight of 261.25 g/mol. Its IUPAC name is 2-(2-methoxy-4-nitrophenyl)sulfonylethanol.
| Compound Name | 2-(2-methoxy-4-nitrophenyl)sulfonylethanol |
|---|---|
| PubChem CID | 172600359 |
| Molecular Formula | C9H11NO6S |
| Molecular Weight | 261.25 g/mol |
| Exact Mass | 261.03 |
| IUPAC Name | 2-(2-methoxy-4-nitrophenyl)sulfonylethanol |
| SMILES | COc1cc([N+](=O)[O-])ccc1S(=O)(=O)CCO |
| InChI | InChI=1S/C9H11NO6S/c1-16-8-6-7(10(12)13)2-3-9(8)17(14,15)5-4-11/h2-3,6,11H,4-5H2,1H3 |
| InChIKey | ARCYPRJEZFWGDJ-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 106.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.25 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|