C14H16O2 — CID 15356461
(2R,3'S)-3'-propan-2-ylspiro[3,4-dihydronaphthalene-2,2'-oxirane]-1-one (PubChem CID 15356461) has the molecular formula C14H16O2 and a molecular weight of 216.28 g/mol. Its IUPAC name is (2R,3'S)-3'-propan-2-ylspiro[3,4-dihydronaphthalene-2,2'-oxirane]-1-one.
| Compound Name | (2R,3'S)-3'-propan-2-ylspiro[3,4-dihydronaphthalene-2,2'-oxirane]-1-one |
|---|---|
| PubChem CID | 15356461 |
| Molecular Formula | C14H16O2 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | (2R,3'S)-3'-propan-2-ylspiro[3,4-dihydronaphthalene-2,2'-oxirane]-1-one |
| SMILES | CC(C)[C@@H]1O[C@]12CCc1ccccc1C2=O |
| InChI | InChI=1S/C14H16O2/c1-9(2)13-14(16-13)8-7-10-5-3-4-6-11(10)12(14)15/h3-6,9,13H,7-8H2,1-2H3/t13-,14-/m0/s1 |
| InChIKey | RFIXBAHZPAWNLH-KBPBESRZSA-N |
| XLogP | 2.61 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|