C12H13FO — CID 10774110
(2S)-2-ethyl-2-fluoro-3,4-dihydronaphthalen-1-one (PubChem CID 10774110) has the molecular formula C12H13FO and a molecular weight of 192.23 g/mol. Its IUPAC name is (2S)-2-ethyl-2-fluoro-3,4-dihydronaphthalen-1-one.
| Compound Name | (2S)-2-ethyl-2-fluoro-3,4-dihydronaphthalen-1-one |
|---|---|
| PubChem CID | 10774110 |
| Molecular Formula | C12H13FO |
| Molecular Weight | 192.23 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | (2S)-2-ethyl-2-fluoro-3,4-dihydronaphthalen-1-one |
| SMILES | CC[C@]1(F)CCc2ccccc2C1=O |
| InChI | InChI=1S/C12H13FO/c1-2-12(13)8-7-9-5-3-4-6-10(9)11(12)14/h3-6H,2,7-8H2,1H3/t12-/m0/s1 |
| InChIKey | GSAIDSAOUXZFIA-LBPRGKRZSA-N |
| XLogP | 2.93 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.23 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |