C14H16O2 — CID 173029100
2,2-diethyl-4H-naphthalene-1,3-dione (PubChem CID 173029100) has the molecular formula C14H16O2 and a molecular weight of 216.28 g/mol. Its IUPAC name is 2,2-diethyl-4H-naphthalene-1,3-dione.
| Compound Name | 2,2-diethyl-4H-naphthalene-1,3-dione |
|---|---|
| PubChem CID | 173029100 |
| Molecular Formula | C14H16O2 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | 2,2-diethyl-4H-naphthalene-1,3-dione |
| SMILES | CCC1(CC)C(=O)Cc2ccccc2C1=O |
| InChI | InChI=1S/C14H16O2/c1-3-14(4-2)12(15)9-10-7-5-6-8-11(10)13(14)16/h5-8H,3-4,9H2,1-2H3 |
| InChIKey | VADKDSSHSWHJMO-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|